C38H33BN4O2 — CID 90199535
1-phenyl-2-[3-(1-phenylbenzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzimidazole (PubChem CID 90199535) has the molecular formula C38H33BN4O2 and a molecular weight of 588.52 g/mol. Its IUPAC name is 1-phenyl-2-[3-(1-phenylbenzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzimidazole.
| Compound Name | 1-phenyl-2-[3-(1-phenylbenzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzimidazole |
|---|---|
| PubChem CID | 90199535 |
| Molecular Formula | C38H33BN4O2 |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 1-phenyl-2-[3-(1-phenylbenzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzimidazole |
| SMILES | CC1(C)OB(c2cc(-c3nc4ccccc4n3-c3ccccc3)cc(-c3nc4ccccc4n3-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C38H33BN4O2/c1-37(2)38(3,4)45-39(44-37)28-24-26(35-40-31-19-11-13-21-33(31)42(35)29-15-7-5-8-16-29)23-27(25-28)36-41-32-20-12-14-22-34(32)43(36)30-17-9-6-10-18-30/h5-25H,1-4H3 |
| InChIKey | AWZSZSYOKWUTSM-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|