C26H37N5O6Si — CID 90200164
[(12E,15S)-5-(methoxycarbonylamino)-11-methyl-9-oxo-17-(2-trimethylsilylethoxymethyl)-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]carbamic acid (PubChem CID 90200164) has the molecular formula C26H37N5O6Si and a molecular weight of 543.70 g/mol. Its IUPAC name is [(12E,15S)-5-(methoxycarbonylamino)-11-methyl-9-oxo-17-(2-trimethylsilylethoxymethyl)-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]carbamic acid.
| Compound Name | [(12E,15S)-5-(methoxycarbonylamino)-11-methyl-9-oxo-17-(2-trimethylsilylethoxymethyl)-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]carbamic acid |
|---|---|
| PubChem CID | 90200164 |
| Molecular Formula | C26H37N5O6Si |
| Molecular Weight | 543.70 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | [(12E,15S)-5-(methoxycarbonylamino)-11-methyl-9-oxo-17-(2-trimethylsilylethoxymethyl)-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]carbamic acid |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CC(C)/C=C/C[C@H](NC(=O)O)c1nc-2cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H37N5O6Si/c1-17-7-6-8-20(30-25(33)34)24-29-22(15-31(24)16-37-11-12-38(3,4)5)19-10-9-18(27-26(35)36-2)14-21(19)28-23(32)13-17/h6-7,9-10,14-15,17,20,30H,8,11-13,16H2,1-5H3,(H,27,35)(H,28,32)(H,33,34)/b7-6+/t17?,20-/m0/s1 |
| InChIKey | KIWYQPIBUVYOQH-KDPXJAPSSA-N |
| XLogP | 5.27 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|