C27H21F3N8O2 — CID 90200264
3-phenyl-2-[2,2,2-trifluoro-1-[[9-[(4-methoxyphenyl)methyl]purin-6-yl]amino]ethyl]pyrrolo[1,2-a][1,3,5]triazin-4-one (PubChem CID 90200264) has the molecular formula C27H21F3N8O2 and a molecular weight of 546.51 g/mol. Its IUPAC name is 3-phenyl-2-[2,2,2-trifluoro-1-[[9-[(4-methoxyphenyl)methyl]purin-6-yl]amino]ethyl]pyrrolo[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 3-phenyl-2-[2,2,2-trifluoro-1-[[9-[(4-methoxyphenyl)methyl]purin-6-yl]amino]ethyl]pyrrolo[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 90200264 |
| Molecular Formula | C27H21F3N8O2 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 3-phenyl-2-[2,2,2-trifluoro-1-[[9-[(4-methoxyphenyl)methyl]purin-6-yl]amino]ethyl]pyrrolo[1,2-a][1,3,5]triazin-4-one |
| SMILES | COc1ccc(Cn2cnc3c(NC(c4nc5cccn5c(=O)n4-c4ccccc4)C(F)(F)F)ncnc32)cc1 |
| InChI | InChI=1S/C27H21F3N8O2/c1-40-19-11-9-17(10-12-19)14-36-16-33-21-23(31-15-32-24(21)36)35-22(27(28,29)30)25-34-20-8-5-13-37(20)26(39)38(25)18-6-3-2-4-7-18/h2-13,15-16,22H,14H2,1H3,(H,31,32,35) |
| InChIKey | UTCXIUJDVYNARG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |