C24H37N5O4Si — CID 90200568
methyl N-[(10R,14S)-14-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate (PubChem CID 90200568) has the molecular formula C24H37N5O4Si and a molecular weight of 487.68 g/mol. Its IUPAC name is methyl N-[(10R,14S)-14-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(10R,14S)-14-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 90200568 |
| Molecular Formula | C24H37N5O4Si |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | methyl N-[(10R,14S)-14-amino-10-methyl-9-oxo-16-(2-trimethylsilylethoxymethyl)-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15(18)-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](N)c1nc-2cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H37N5O4Si/c1-16-7-6-8-19(25)22-27-21(14-29(22)15-33-11-12-34(3,4)5)18-10-9-17(26-24(31)32-2)13-20(18)28-23(16)30/h9-10,13-14,16,19H,6-8,11-12,15,25H2,1-5H3,(H,26,31)(H,28,30)/t16-,19+/m1/s1 |
| InChIKey | GTWFFWDLGQMWFK-APWZRJJASA-N |
| XLogP | 4.80 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|