About 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride
5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride (PubChem CID 90201097) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride |
| PubChem CID | 90201097 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride |
| SMILES | CCc1c(C)nc(=O)n(O)c1C.Cl |
| InChI | InChI=1S/C8H12N2O2.ClH/c1-4-7-5(2)9-8(11)10(12)6(7)3;/h12H,4H2,1-3H3;1H |
| InChIKey | BXVYXWMTDZLYKG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride?
The IUPAC name of 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride (CID 90201097) is 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride.
What is the SMILES notation for 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride?
The canonical SMILES for 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride is CCc1c(C)nc(=O)n(O)c1C.Cl.
What is the InChIKey of 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride?
The InChIKey is BXVYXWMTDZLYKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.ClH/c1-4-7-5(2)9-8(11)10(12)6(7)3;/h12H,4H2,1-3H3;1H.
What are the key properties of 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride?
5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride has a molecular weight of 204.66 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-hydroxy-4,6-dimethylpyrimidin-2-one;hydrochloride is sourced from PubChem (CID 90201097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).