C35H22N4OS — CID 90201571
2-(4,6-diphenylpyrimidin-2-yl)-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine (PubChem CID 90201571) has the molecular formula C35H22N4OS and a molecular weight of 546.66 g/mol. Its IUPAC name is 2-(4,6-diphenylpyrimidin-2-yl)-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine.
| Compound Name | 2-(4,6-diphenylpyrimidin-2-yl)-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine |
|---|---|
| PubChem CID | 90201571 |
| Molecular Formula | C35H22N4OS |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-(4,6-diphenylpyrimidin-2-yl)-5-phenyl-[1,3]thiazolo[4,5-b]phenoxazine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3nc4cc5c(cc4s3)Oc3ccccc3N5c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H22N4OS/c1-4-12-23(13-5-1)26-20-27(24-14-6-2-7-15-24)37-34(36-26)35-38-28-21-30-32(22-33(28)41-35)40-31-19-11-10-18-29(31)39(30)25-16-8-3-9-17-25/h1-22H |
| InChIKey | HRMZOPFQVNHZCZ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |