C46H30N6O — CID 90201708
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5,10-diphenyl-[1,3]oxazolo[5,4-b]phenazine (PubChem CID 90201708) has the molecular formula C46H30N6O and a molecular weight of 682.79 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5,10-diphenyl-[1,3]oxazolo[5,4-b]phenazine.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5,10-diphenyl-[1,3]oxazolo[5,4-b]phenazine |
|---|---|
| PubChem CID | 90201708 |
| Molecular Formula | C46H30N6O |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-5,10-diphenyl-[1,3]oxazolo[5,4-b]phenazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc5cc6c(cc5o4)N(c4ccccc4)c4ccccc4N6c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C46H30N6O/c1-5-15-31(16-6-1)43-48-44(32-17-7-2-8-18-32)50-45(49-43)33-25-27-34(28-26-33)46-47-37-29-40-41(30-42(37)53-46)52(36-21-11-4-12-22-36)39-24-14-13-23-38(39)51(40)35-19-9-3-10-20-35/h1-30H |
| InChIKey | LSSFRHANMNMYHM-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 71.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |