C47H84N4O8 — CID 90201752
1-O,3-O,4-O-tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate (PubChem CID 90201752) has the molecular formula C47H84N4O8 and a molecular weight of 833.21 g/mol. Its IUPAC name is 1-O,3-O,4-O-tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O,3-O,4-O-tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 90201752 |
| Molecular Formula | C47H84N4O8 |
| Molecular Weight | 833.21 g/mol |
| Exact Mass | 832.63 |
| IUPAC Name | 1-O,3-O,4-O-tris(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-O-(2,2,6,6-tetramethylpiperidin-4-yl) butane-1,2,3,4-tetracarboxylate |
| SMILES | CN1C(C)(C)CC(OC(=O)CC(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(CC(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C47H84N4O8/c1-40(2)22-30(23-41(3,4)48-40)58-38(54)34(20-36(52)56-31-24-42(5,6)49(17)43(7,8)25-31)35(39(55)59-33-28-46(13,14)51(19)47(15,16)29-33)21-37(53)57-32-26-44(9,10)50(18)45(11,12)27-32/h30-35,48H,20-29H2,1-19H3 |
| InChIKey | JDZVOTYDHXHYMZ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.21 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|