C29H35BN4O5 — CID 90201929
methyl N-[(1S)-2-oxo-1-phenyl-2-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 90201929) has the molecular formula C29H35BN4O5 and a molecular weight of 530.43 g/mol. Its IUPAC name is methyl N-[(1S)-2-oxo-1-phenyl-2-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[(1S)-2-oxo-1-phenyl-2-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 90201929 |
| Molecular Formula | C29H35BN4O5 |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | methyl N-[(1S)-2-oxo-1-phenyl-2-[(2S)-2-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1H-imidazol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1c1ncc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C29H35BN4O5/c1-28(2)29(3,4)39-30(38-28)21-15-13-19(14-16-21)22-18-31-25(32-22)23-12-9-17-34(23)26(35)24(33-27(36)37-5)20-10-7-6-8-11-20/h6-8,10-11,13-16,18,23-24H,9,12,17H2,1-5H3,(H,31,32)(H,33,36)/t23-,24-/m0/s1 |
| InChIKey | GTWZYOWWBMXKSO-ZEQRLZLVSA-N |
| XLogP | 4.14 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|