C25H32N4O6 — CID 90201965
tert-butyl N-[2-[[(4S,7R,9aS)-7-(indole-1-carbonyl)-5-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]oxazepin-4-yl]amino]-2-oxoethyl]-N-methylcarbamate (PubChem CID 90201965) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[(4S,7R,9aS)-7-(indole-1-carbonyl)-5-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]oxazepin-4-yl]amino]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(4S,7R,9aS)-7-(indole-1-carbonyl)-5-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]oxazepin-4-yl]amino]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90201965 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl N-[2-[[(4S,7R,9aS)-7-(indole-1-carbonyl)-5-oxo-3,4,7,8,9,9a-hexahydro-2H-pyrrolo[2,1-b][1,3]oxazepin-4-yl]amino]-2-oxoethyl]-N-methylcarbamate |
| SMILES | CN(CC(=O)N[C@H]1CCO[C@H]2CC[C@H](C(=O)n3ccc4ccccc43)N2C1=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H32N4O6/c1-25(2,3)35-24(33)27(4)15-20(30)26-17-12-14-34-21-10-9-19(29(21)22(17)31)23(32)28-13-11-16-7-5-6-8-18(16)28/h5-8,11,13,17,19,21H,9-10,12,14-15H2,1-4H3,(H,26,30)/t17-,19+,21-/m0/s1 |
| InChIKey | GAGHJWMKLZWTKB-DSKINZAPSA-N |
| XLogP | 2.37 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |