About 8-butoxynon-8-en-1-amine
8-butoxynon-8-en-1-amine (PubChem CID 90202015) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 8-butoxynon-8-en-1-amine.
Molecular Properties
| Compound Name | 8-butoxynon-8-en-1-amine |
| PubChem CID | 90202015 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 8-butoxynon-8-en-1-amine |
| SMILES | C=C(CCCCCCCN)OCCCC |
| InChI | InChI=1S/C13H27NO/c1-3-4-12-15-13(2)10-8-6-5-7-9-11-14/h2-12,14H2,1H3 |
| InChIKey | VFJXSVYJDALDAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-butoxynon-8-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-butoxynon-8-en-1-amine?
The IUPAC name of 8-butoxynon-8-en-1-amine (CID 90202015) is 8-butoxynon-8-en-1-amine.
What is the SMILES notation for 8-butoxynon-8-en-1-amine?
The canonical SMILES for 8-butoxynon-8-en-1-amine is C=C(CCCCCCCN)OCCCC.
What is the InChIKey of 8-butoxynon-8-en-1-amine?
The InChIKey is VFJXSVYJDALDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-3-4-12-15-13(2)10-8-6-5-7-9-11-14/h2-12,14H2,1H3.
What are the key properties of 8-butoxynon-8-en-1-amine?
8-butoxynon-8-en-1-amine has a molecular weight of 213.36 g/mol, XLogP of 3.62, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-butoxynon-8-en-1-amine is sourced from PubChem (CID 90202015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).