C14H28O2Si2 — CID 90202087
[(1R,6S)-5,6-dimethoxy-4-trimethylsilylcyclohexa-2,4-dien-1-yl]-trimethylsilane (PubChem CID 90202087) has the molecular formula C14H28O2Si2 and a molecular weight of 284.55 g/mol. Its IUPAC name is [(1R,6S)-5,6-dimethoxy-4-trimethylsilylcyclohexa-2,4-dien-1-yl]-trimethylsilane.
| Compound Name | [(1R,6S)-5,6-dimethoxy-4-trimethylsilylcyclohexa-2,4-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 90202087 |
| Molecular Formula | C14H28O2Si2 |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | [(1R,6S)-5,6-dimethoxy-4-trimethylsilylcyclohexa-2,4-dien-1-yl]-trimethylsilane |
| SMILES | COC1=C([Si](C)(C)C)C=C[C@@H]([Si](C)(C)C)[C@H]1OC |
| InChI | InChI=1S/C14H28O2Si2/c1-15-13-11(17(3,4)5)9-10-12(14(13)16-2)18(6,7)8/h9-11,13H,1-8H3/t11-,13-/m1/s1 |
| InChIKey | QLYJUBGYDMRJCU-DGCLKSJQSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|