C15H24BNO3 — CID 90202650
N-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 90202650) has the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | N-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 90202650 |
| Molecular Formula | C15H24BNO3 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | COCCNc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C15H24BNO3/c1-14(2)15(3,4)20-16(19-14)12-6-8-13(9-7-12)17-10-11-18-5/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | HKYDNIHLNFKPSO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|