About 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole
3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole (PubChem CID 90202651) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole |
| PubChem CID | 90202651 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole |
| SMILES | Cc1cccc(C)c1OCc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C18H17NO2/c1-13-4-3-5-14(2)18(13)20-12-15-6-8-16(9-7-15)17-10-11-21-19-17/h3-11H,12H2,1-2H3 |
| InChIKey | CPBWGZSZHJCEMC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole?
The IUPAC name of 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole (CID 90202651) is 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole.
What is the SMILES notation for 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole?
The canonical SMILES for 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole is Cc1cccc(C)c1OCc1ccc(-c2ccon2)cc1.
What is the InChIKey of 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole?
The InChIKey is CPBWGZSZHJCEMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-13-4-3-5-14(2)18(13)20-12-15-6-8-16(9-7-15)17-10-11-21-19-17/h3-11H,12H2,1-2H3.
What are the key properties of 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole?
3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole has a molecular weight of 279.34 g/mol, XLogP of 4.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,6-dimethylphenoxy)methyl]phenyl]-1,2-oxazole is sourced from PubChem (CID 90202651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).