About 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid
2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid (PubChem CID 90203134) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid |
| PubChem CID | 90203134 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)CC(C(N)=O)N(C(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O3/c1-8(2)3-5(6(9)11)10(4-8)7(12)13/h5H,3-4H2,1-2H3,(H2,9,11)(H,12,13) |
| InChIKey | CWQOZRHNFLHIPV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid?
The IUPAC name of 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid (CID 90203134) is 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid.
What is the SMILES notation for 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid?
The canonical SMILES for 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid is CC1(C)CC(C(N)=O)N(C(=O)O)C1.
What is the InChIKey of 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid?
The InChIKey is CWQOZRHNFLHIPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-8(2)3-5(6(9)11)10(4-8)7(12)13/h5H,3-4H2,1-2H3,(H2,9,11)(H,12,13).
What are the key properties of 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid?
2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid has a molecular weight of 186.21 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoyl-4,4-dimethylpyrrolidine-1-carboxylic acid is sourced from PubChem (CID 90203134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).