About methyl 2-cyano-4-methylbenzoate
methyl 2-cyano-4-methylbenzoate (PubChem CID 90205580) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is methyl 2-cyano-4-methylbenzoate.
Molecular Properties
| Compound Name | methyl 2-cyano-4-methylbenzoate |
| PubChem CID | 90205580 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | methyl 2-cyano-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)cc1C#N |
| InChI | InChI=1S/C10H9NO2/c1-7-3-4-9(10(12)13-2)8(5-7)6-11/h3-5H,1-2H3 |
| InChIKey | RLGXGTZNMCDVFB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-cyano-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyano-4-methylbenzoate?
The IUPAC name of methyl 2-cyano-4-methylbenzoate (CID 90205580) is methyl 2-cyano-4-methylbenzoate.
What is the SMILES notation for methyl 2-cyano-4-methylbenzoate?
The canonical SMILES for methyl 2-cyano-4-methylbenzoate is COC(=O)c1ccc(C)cc1C#N.
What is the InChIKey of methyl 2-cyano-4-methylbenzoate?
The InChIKey is RLGXGTZNMCDVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-7-3-4-9(10(12)13-2)8(5-7)6-11/h3-5H,1-2H3.
What are the key properties of methyl 2-cyano-4-methylbenzoate?
methyl 2-cyano-4-methylbenzoate has a molecular weight of 175.19 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyano-4-methylbenzoate is sourced from PubChem (CID 90205580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).