C17H20N4O — CID 90205745
[4-(3-amino-4-pyridinyl)phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 90205745) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is [4-(3-amino-4-pyridinyl)phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-(3-amino-4-pyridinyl)phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90205745 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [4-(3-amino-4-pyridinyl)phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-c3ccncc3N)cc2)CC1 |
| InChI | InChI=1S/C17H20N4O/c1-20-8-10-21(11-9-20)17(22)14-4-2-13(3-5-14)15-6-7-19-12-16(15)18/h2-7,12H,8-11,18H2,1H3 |
| InChIKey | WUMALIHZVQLBKI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |