About 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane
5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane (PubChem CID 90205947) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
| PubChem CID | 90205947 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane |
| SMILES | C=C/C=C/C1CC2(CCO1)CO2 |
| InChI | InChI=1S/C10H14O2/c1-2-3-4-9-7-10(8-12-10)5-6-11-9/h2-4,9H,1,5-8H2/b4-3+ |
| InChIKey | RTXHQQLMDBVYKH-ONEGZZNKSA-N |
| XLogP | 1.68 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane?
The IUPAC name of 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane (CID 90205947) is 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane.
What is the SMILES notation for 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane?
The canonical SMILES for 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane is C=C/C=C/C1CC2(CCO1)CO2.
What is the InChIKey of 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane?
The InChIKey is RTXHQQLMDBVYKH-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H14O2/c1-2-3-4-9-7-10(8-12-10)5-6-11-9/h2-4,9H,1,5-8H2/b4-3+.
What are the key properties of 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane?
5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane has a molecular weight of 166.22 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1E)-buta-1,3-dienyl]-1,6-dioxaspiro[2.5]octane is sourced from PubChem (CID 90205947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).