C15H8F3NO4 — CID 90206084
ethynyl 2-(2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)acetate (PubChem CID 90206084) has the molecular formula C15H8F3NO4 and a molecular weight of 323.23 g/mol. Its IUPAC name is ethynyl 2-(2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)acetate.
| Compound Name | ethynyl 2-(2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)acetate |
|---|---|
| PubChem CID | 90206084 |
| Molecular Formula | C15H8F3NO4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | ethynyl 2-(2,2,7-trifluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)acetate |
| SMILES | C#CCN1C(=O)C(F)(F)Oc2cc(F)c(CC(=O)OC#C)cc21 |
| InChI | InChI=1S/C15H8F3NO4/c1-3-5-19-11-6-9(7-13(20)22-4-2)10(16)8-12(11)23-15(17,18)14(19)21/h1-2,6,8H,5,7H2 |
| InChIKey | PFZIFXXNTZRJGP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|