About 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine
6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine (PubChem CID 90206326) has the molecular formula C6H9FOS
and a molecular weight of 148.20 g/mol. Its IUPAC name is 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine.
Molecular Properties
| Compound Name | 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine |
| PubChem CID | 90206326 |
| Molecular Formula | C6H9FOS |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine |
| SMILES | CC1=C(CF)OCCS1 |
| InChI | InChI=1S/C6H9FOS/c1-5-6(4-7)8-2-3-9-5/h2-4H2,1H3 |
| InChIKey | GNACBHRPYLEXGL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine?
The IUPAC name of 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine (CID 90206326) is 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine.
What is the SMILES notation for 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine?
The canonical SMILES for 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine is CC1=C(CF)OCCS1.
What is the InChIKey of 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine?
The InChIKey is GNACBHRPYLEXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FOS/c1-5-6(4-7)8-2-3-9-5/h2-4H2,1H3.
What are the key properties of 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine?
6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine has a molecular weight of 148.20 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(fluoromethyl)-5-methyl-2,3-dihydro-1,4-oxathiine is sourced from PubChem (CID 90206326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).