C22H34F3IO7S — CID 90206672
3-[(3aS)-3a-(iodomethyl)-5-[(2R)-2-methyl-3-(trifluoromethylsulfonyloxy)but-3-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 90206672) has the molecular formula C22H34F3IO7S and a molecular weight of 626.47 g/mol. Its IUPAC name is 3-[(3aS)-3a-(iodomethyl)-5-[(2R)-2-methyl-3-(trifluoromethylsulfonyloxy)but-3-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(3aS)-3a-(iodomethyl)-5-[(2R)-2-methyl-3-(trifluoromethylsulfonyloxy)but-3-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90206672 |
| Molecular Formula | C22H34F3IO7S |
| Molecular Weight | 626.47 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | 3-[(3aS)-3a-(iodomethyl)-5-[(2R)-2-methyl-3-(trifluoromethylsulfonyloxy)but-3-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C(OS(=O)(=O)C(F)(F)F)[C@H](C)CC1CCC2OC(CCCOC(=O)C(C)(C)C)C[C@]2(CI)O1 |
| InChI | InChI=1S/C22H34F3IO7S/c1-14(15(2)33-34(28,29)22(23,24)25)11-16-8-9-18-21(13-26,32-16)12-17(31-18)7-6-10-30-19(27)20(3,4)5/h14,16-18H,2,6-13H2,1,3-5H3/t14-,16?,17?,18?,21-/m1/s1 |
| InChIKey | SXFLIOXFLFLPQP-INMJNZOJSA-N |
| XLogP | 5.27 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|