C13H19NO2 — CID 90206835
1',5,6-trimethylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]-2',5'-dione (PubChem CID 90206835) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1',5,6-trimethylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 1',5,6-trimethylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 90206835 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1',5,6-trimethylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]-2',5'-dione |
| SMILES | CC1C2CC(C1C)C1(CC(=O)N(C)C1=O)C2 |
| InChI | InChI=1S/C13H19NO2/c1-7-8(2)10-4-9(7)5-13(10)6-11(15)14(3)12(13)16/h7-10H,4-6H2,1-3H3 |
| InChIKey | NVKZYHBQZXMFMP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|