About 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline
4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline (PubChem CID 90207069) has the molecular formula C18H23N5
and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline.
Molecular Properties
| Compound Name | 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline |
| PubChem CID | 90207069 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline |
| SMILES | CN1Cc2nc(N3CCCCC3)nc(-c3ccc(N)cc3)c2C1 |
| InChI | InChI=1S/C18H23N5/c1-22-11-15-16(12-22)20-18(23-9-3-2-4-10-23)21-17(15)13-5-7-14(19)8-6-13/h5-8H,2-4,9-12,19H2,1H3 |
| InChIKey | FJXCDODAPDDLTO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline?
The IUPAC name of 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline (CID 90207069) is 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline.
What is the SMILES notation for 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline?
The canonical SMILES for 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline is CN1Cc2nc(N3CCCCC3)nc(-c3ccc(N)cc3)c2C1.
What is the InChIKey of 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline?
The InChIKey is FJXCDODAPDDLTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5/c1-22-11-15-16(12-22)20-18(23-9-3-2-4-10-23)21-17(15)13-5-7-14(19)8-6-13/h5-8H,2-4,9-12,19H2,1H3.
What are the key properties of 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline?
4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline has a molecular weight of 309.42 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methyl-2-piperidin-1-yl-5,7-dihydropyrrolo[3,4-d]pyrimidin-4-yl)aniline is sourced from PubChem (CID 90207069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).