C26H28FN5O2 — CID 90207283
(E)-4-(3-azabicyclo[3.1.0]hexan-3-yl)-N-[7-ethoxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]but-2-enamide (PubChem CID 90207283) has the molecular formula C26H28FN5O2 and a molecular weight of 461.54 g/mol. Its IUPAC name is (E)-4-(3-azabicyclo[3.1.0]hexan-3-yl)-N-[7-ethoxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]but-2-enamide.
| Compound Name | (E)-4-(3-azabicyclo[3.1.0]hexan-3-yl)-N-[7-ethoxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 90207283 |
| Molecular Formula | C26H28FN5O2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (E)-4-(3-azabicyclo[3.1.0]hexan-3-yl)-N-[7-ethoxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]but-2-enamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(C)c3)c2cc1NC(=O)/C=C/CN1CC2CC2C1 |
| InChI | InChI=1S/C26H28FN5O2/c1-3-34-24-12-22-20(26(29-15-28-22)30-19-6-7-21(27)16(2)9-19)11-23(24)31-25(33)5-4-8-32-13-17-10-18(17)14-32/h4-7,9,11-12,15,17-18H,3,8,10,13-14H2,1-2H3,(H,31,33)(H,28,29,30)/b5-4+ |
| InChIKey | CUCAZAKYXBEZAL-SNAWJCMRSA-N |
| XLogP | 4.67 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|