C52H102N4O8 — CID 90207739
methyl 3-[2-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethyl-ethylamino]ethyl-methylamino]ethyl-(3-decoxy-3-oxopropyl)amino]propanoate (PubChem CID 90207739) has the molecular formula C52H102N4O8 and a molecular weight of 911.41 g/mol. Its IUPAC name is methyl 3-[2-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethyl-ethylamino]ethyl-methylamino]ethyl-(3-decoxy-3-oxopropyl)amino]propanoate.
| Compound Name | methyl 3-[2-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethyl-ethylamino]ethyl-methylamino]ethyl-(3-decoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 90207739 |
| Molecular Formula | C52H102N4O8 |
| Molecular Weight | 911.41 g/mol |
| Exact Mass | 910.77 |
| IUPAC Name | methyl 3-[2-[2-[2-[bis(3-decoxy-3-oxopropyl)amino]ethyl-ethylamino]ethyl-methylamino]ethyl-(3-decoxy-3-oxopropyl)amino]propanoate |
| SMILES | CCCCCCCCCCOC(=O)CCN(CCC(=O)OC)CCN(C)CCN(CC)CCN(CCC(=O)OCCCCCCCCCC)CCC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C52H102N4O8/c1-7-11-14-17-20-23-26-29-46-62-50(58)33-37-55(36-32-49(57)61-6)43-41-53(5)40-42-54(10-4)44-45-56(38-34-51(59)63-47-30-27-24-21-18-15-12-8-2)39-35-52(60)64-48-31-28-25-22-19-16-13-9-3/h7-48H2,1-6H3 |
| InChIKey | QXGSGGKXANIRRN-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.41 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|