C22H26N2O4 — CID 90207829
(1S,2R,9S,12R,13R)-9-hydroxy-12,13-dimethyl-2-(methylaminomethyl)-6-phenylmethoxy-4-oxa-5-azatricyclo[7.2.2.03,7]trideca-3(7),5,10-trien-8-one (PubChem CID 90207829) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is (1S,2R,9S,12R,13R)-9-hydroxy-12,13-dimethyl-2-(methylaminomethyl)-6-phenylmethoxy-4-oxa-5-azatricyclo[7.2.2.03,7]trideca-3(7),5,10-trien-8-one.
| Compound Name | (1S,2R,9S,12R,13R)-9-hydroxy-12,13-dimethyl-2-(methylaminomethyl)-6-phenylmethoxy-4-oxa-5-azatricyclo[7.2.2.03,7]trideca-3(7),5,10-trien-8-one |
|---|---|
| PubChem CID | 90207829 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | (1S,2R,9S,12R,13R)-9-hydroxy-12,13-dimethyl-2-(methylaminomethyl)-6-phenylmethoxy-4-oxa-5-azatricyclo[7.2.2.03,7]trideca-3(7),5,10-trien-8-one |
| SMILES | CNC[C@@H]1c2onc(OCc3ccccc3)c2C(=O)[C@]2(O)C=C[C@H]1[C@@H](C)[C@H]2C |
| InChI | InChI=1S/C22H26N2O4/c1-13-14(2)22(26)10-9-16(13)17(11-23-3)19-18(20(22)25)21(24-28-19)27-12-15-7-5-4-6-8-15/h4-10,13-14,16-17,23,26H,11-12H2,1-3H3/t13-,14+,16-,17-,22-/m0/s1 |
| InChIKey | PHVNHDSHSSYZLH-TYNJGJATSA-N |
| XLogP | 2.94 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|