C20H34BCl — CID 90207888
chloro-[(1R,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane (PubChem CID 90207888) has the molecular formula C20H34BCl and a molecular weight of 320.76 g/mol. Its IUPAC name is chloro-[(1R,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane.
| Compound Name | chloro-[(1R,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane |
|---|---|
| PubChem CID | 90207888 |
| Molecular Formula | C20H34BCl |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | chloro-[(1R,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-[(1S,3R)-3,6,6-trimethyl-2-bicyclo[3.1.1]heptanyl]borane |
| SMILES | C[C@@H]1CC2C[C@@H](C1B(Cl)C1C[C@@H]3C[C@H]([C@H]1C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C20H34BCl/c1-11-7-13-9-16(20(13,5)6)18(11)21(22)17-10-14-8-15(12(17)2)19(14,3)4/h11-18H,7-10H2,1-6H3/t11-,12-,13?,14+,15-,16+,17?,18?/m1/s1 |
| InChIKey | ARPQVOWQZONKFJ-NXZSMXIGSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|