C13H17N3O3 — CID 90207927
N-(5-cyano-4-methyl-2,6-dioxo-3H-pyridin-1-yl)-N,2,2-trimethylpropanamide (PubChem CID 90207927) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-(5-cyano-4-methyl-2,6-dioxo-3H-pyridin-1-yl)-N,2,2-trimethylpropanamide.
| Compound Name | N-(5-cyano-4-methyl-2,6-dioxo-3H-pyridin-1-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 90207927 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(5-cyano-4-methyl-2,6-dioxo-3H-pyridin-1-yl)-N,2,2-trimethylpropanamide |
| SMILES | CC1=C(C#N)C(=O)N(N(C)C(=O)C(C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C13H17N3O3/c1-8-6-10(17)16(11(18)9(8)7-14)15(5)12(19)13(2,3)4/h6H2,1-5H3 |
| InChIKey | NYZZRXURRZTDEV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|