C29H46N2OS — CID 90207933
2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 90207933) has the molecular formula C29H46N2OS and a molecular weight of 470.77 g/mol. Its IUPAC name is 2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 90207933 |
| Molecular Formula | C29H46N2OS |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(-c2c(C)cc(C)cc2C)c(C=O)s1 |
| InChI | InChI=1S/C29H46N2OS/c1-8-12-14-24(10-3)18-31(19-25(11-4)15-13-9-2)29-30-28(26(20-32)33-29)27-22(6)16-21(5)17-23(27)7/h16-17,20,24-25H,8-15,18-19H2,1-7H3 |
| InChIKey | MMMZUQIRXCFADU-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|