C44H67N5O2S — CID 90207962
(5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dibutylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 90207962) has the molecular formula C44H67N5O2S and a molecular weight of 730.12 g/mol. Its IUPAC name is (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dibutylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dibutylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90207962 |
| Molecular Formula | C44H67N5O2S |
| Molecular Weight | 730.12 g/mol |
| Exact Mass | 729.50 |
| IUPAC Name | (5Z)-5-[[2-[bis(2-ethylhexyl)amino]-4-(2,4,6-trimethylphenyl)-1,3-thiazol-5-yl]methylidene]-1-(dibutylamino)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1nc(-c2c(C)cc(C)cc2C)c(/C=C2\C(=O)N(N(CCCC)CCCC)C(=O)C(C#N)=C2C)s1 |
| InChI | InChI=1S/C44H67N5O2S/c1-11-17-21-35(15-5)29-47(30-36(16-6)22-18-12-2)44-46-41(40-32(8)25-31(7)26-33(40)9)39(52-44)27-37-34(10)38(28-45)43(51)49(42(37)50)48(23-19-13-3)24-20-14-4/h25-27,35-36H,11-24,29-30H2,1-10H3/b37-27- |
| InChIKey | VPEXEHALGYRFEB-QOSQFQCFSA-N |
| XLogP | 11.38 |
| TPSA | 80.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.12 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|