About N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide
N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide (PubChem CID 9020846) has the molecular formula C18H12ClFN4O4
and a molecular weight of 402.77 g/mol. Its IUPAC name is N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide.
Molecular Properties
| Compound Name | N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| PubChem CID | 9020846 |
| Molecular Formula | C18H12ClFN4O4 |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cncn1-c1ccc(F)cc1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C18H12ClFN4O4/c19-13-5-10(6-15-16(13)28-9-27-15)17(25)22-23-18(26)14-7-21-8-24(14)12-3-1-11(20)2-4-12/h1-8H,9H2,(H,22,25)(H,23,26) |
| InChIKey | IVUIUCLWLBQAQO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide?
The IUPAC name of N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide (CID 9020846) is N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide.
What is the SMILES notation for N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide?
The canonical SMILES for N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide is O=C(NNC(=O)c1cncn1-c1ccc(F)cc1)c1cc(Cl)c2c(c1)OCO2.
What is the InChIKey of N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide?
The InChIKey is IVUIUCLWLBQAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN4O4/c19-13-5-10(6-15-16(13)28-9-27-15)17(25)22-23-18(26)14-7-21-8-24(14)12-3-1-11(20)2-4-12/h1-8H,9H2,(H,22,25)(H,23,26).
What are the key properties of N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide?
N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide has a molecular weight of 402.77 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7-chloro-1,3-benzodioxole-5-carbonyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide is sourced from PubChem (CID 9020846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).