C18H20F6O4 — CID 90208500
(4-ethenylphenyl)methyl 3,3,3-trifluoro-2-(1-methoxy-2-methylpropoxy)-2-(trifluoromethyl)propanoate (PubChem CID 90208500) has the molecular formula C18H20F6O4 and a molecular weight of 414.34 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 3,3,3-trifluoro-2-(1-methoxy-2-methylpropoxy)-2-(trifluoromethyl)propanoate.
| Compound Name | (4-ethenylphenyl)methyl 3,3,3-trifluoro-2-(1-methoxy-2-methylpropoxy)-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 90208500 |
| Molecular Formula | C18H20F6O4 |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (4-ethenylphenyl)methyl 3,3,3-trifluoro-2-(1-methoxy-2-methylpropoxy)-2-(trifluoromethyl)propanoate |
| SMILES | C=Cc1ccc(COC(=O)C(OC(OC)C(C)C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F6O4/c1-5-12-6-8-13(9-7-12)10-27-15(25)16(17(19,20)21,18(22,23)24)28-14(26-4)11(2)3/h5-9,11,14H,1,10H2,2-4H3 |
| InChIKey | JRDYLTFHQQLNAY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|