C19H22F6O4 — CID 90208501
(4-ethenylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 90208501) has the molecular formula C19H22F6O4 and a molecular weight of 428.37 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (4-ethenylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 90208501 |
| Molecular Formula | C19H22F6O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | C=Cc1ccc(COC(=O)C(OCOCC(C)(C)C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H22F6O4/c1-5-13-6-8-14(9-7-13)10-28-15(26)17(18(20,21)22,19(23,24)25)29-12-27-11-16(2,3)4/h5-9H,1,10-12H2,2-4H3 |
| InChIKey | BAOIWBMRWHZHCM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|