C24H26F6O4 — CID 90208511
(4-ethenylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 90208511) has the molecular formula C24H26F6O4 and a molecular weight of 492.46 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (4-ethenylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 90208511 |
| Molecular Formula | C24H26F6O4 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (4-ethenylphenyl)methyl 2-(2-adamantyloxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | C=Cc1ccc(COC(=O)C(OCOC2C3CC4CC(C3)CC2C4)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H26F6O4/c1-2-14-3-5-15(6-4-14)12-32-21(31)22(23(25,26)27,24(28,29)30)34-13-33-20-18-8-16-7-17(10-18)11-19(20)9-16/h2-6,16-20H,1,7-13H2 |
| InChIKey | QGJMVMZLMWSXHF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|