C21H28F6O4 — CID 90208532
(4-butan-2-ylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 90208532) has the molecular formula C21H28F6O4 and a molecular weight of 458.44 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | (4-butan-2-ylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 90208532 |
| Molecular Formula | C21H28F6O4 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (4-butan-2-ylphenyl)methyl 2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | CCC(C)c1ccc(COC(=O)C(OCOCC(C)(C)C)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H28F6O4/c1-6-14(2)16-9-7-15(8-10-16)11-30-17(28)19(20(22,23)24,21(25,26)27)31-13-29-12-18(3,4)5/h7-10,14H,6,11-13H2,1-5H3 |
| InChIKey | VPZYHXQDJNXOEL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|