C40H36N3O6P3 — CID 90208696
(1S)-3-methyl-1,4,4,6,6,9-hexaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene (PubChem CID 90208696) has the molecular formula C40H36N3O6P3 and a molecular weight of 747.67 g/mol. Its IUPAC name is (1S)-3-methyl-1,4,4,6,6,9-hexaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene.
| Compound Name | (1S)-3-methyl-1,4,4,6,6,9-hexaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene |
|---|---|
| PubChem CID | 90208696 |
| Molecular Formula | C40H36N3O6P3 |
| Molecular Weight | 747.67 g/mol |
| Exact Mass | 747.18 |
| IUPAC Name | (1S)-3-methyl-1,4,4,6,6,9-hexaphenoxy-2,5,7-triaza-1λ5,4λ5,6λ5-triphosphabicyclo[6.1.0]nona-1,4,6-triene |
| SMILES | CC1N=[P@]2(Oc3ccccc3)C(N=P(Oc3ccccc3)(Oc3ccccc3)N=P1(Oc1ccccc1)Oc1ccccc1)C2Oc1ccccc1 |
| InChI | InChI=1S/C40H36N3O6P3/c1-32-41-50(45-34-22-10-3-11-23-34)39(40(50)44-33-20-8-2-9-21-33)42-52(48-37-28-16-6-17-29-37,49-38-30-18-7-19-31-38)43-51(32,46-35-24-12-4-13-25-35)47-36-26-14-5-15-27-36/h2-32,39-40H,1H3/t32?,39?,40?,50-/m0/s1 |
| InChIKey | BHCCGJQYNAGKFI-QUQHAMKLSA-N |
| XLogP | 12.58 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.67 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|