About methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate
methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate (PubChem CID 90208773) has the molecular formula C14H30N4O2
and a molecular weight of 286.42 g/mol. Its IUPAC name is methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate |
| PubChem CID | 90208773 |
| Molecular Formula | C14H30N4O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate |
| SMILES | COC(=O)CCNCCN1C[C@@H](C)N(CCN)C[C@@H]1C |
| InChI | InChI=1S/C14H30N4O2/c1-12-11-18(13(2)10-17(12)8-5-15)9-7-16-6-4-14(19)20-3/h12-13,16H,4-11,15H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | FSCHEQQIUGKFIT-OLZOCXBDSA-N |
| XLogP | -0.51 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate?
The IUPAC name of methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate (CID 90208773) is methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate.
What is the SMILES notation for methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate?
The canonical SMILES for methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate is COC(=O)CCNCCN1C[C@@H](C)N(CCN)C[C@@H]1C.
What is the InChIKey of methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate?
The InChIKey is FSCHEQQIUGKFIT-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H30N4O2/c1-12-11-18(13(2)10-17(12)8-5-15)9-7-16-6-4-14(19)20-3/h12-13,16H,4-11,15H2,1-3H3/t12-,13+/m1/s1.
What are the key properties of methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate?
methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate has a molecular weight of 286.42 g/mol, XLogP of -0.51, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-[(2S,5R)-4-(2-aminoethyl)-2,5-dimethylpiperazin-1-yl]ethylamino]propanoate is sourced from PubChem (CID 90208773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).