About methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate
methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 90208876) has the molecular formula C11H16O4
and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 90208876 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)[C@]1(OC(C)C)C=CC=C[C@H]1O |
| InChI | InChI=1S/C11H16O4/c1-8(2)15-11(10(13)14-3)7-5-4-6-9(11)12/h4-9,12H,1-3H3/t9-,11+/m1/s1 |
| InChIKey | OMZNXYBXOOGSKQ-KOLCDFICSA-N |
| XLogP | 0.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate (CID 90208876) is methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate is COC(=O)[C@]1(OC(C)C)C=CC=C[C@H]1O.
What is the InChIKey of methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is OMZNXYBXOOGSKQ-KOLCDFICSA-N. The full InChI is InChI=1S/C11H16O4/c1-8(2)15-11(10(13)14-3)7-5-4-6-9(11)12/h4-9,12H,1-3H3/t9-,11+/m1/s1.
What are the key properties of methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate?
methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 212.24 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,6R)-6-hydroxy-1-propan-2-yloxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 90208876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).