C28H40N2O6Si — CID 90208878
[3-butoxy-5-[(dimethylamino)methyl]-1,2-oxazol-4-yl]-[(1S,6R)-1-(phenylmethoxymethoxy)-6-trimethylsilyloxycyclohexa-2,4-dien-1-yl]methanone (PubChem CID 90208878) has the molecular formula C28H40N2O6Si and a molecular weight of 528.72 g/mol. Its IUPAC name is [3-butoxy-5-[(dimethylamino)methyl]-1,2-oxazol-4-yl]-[(1S,6R)-1-(phenylmethoxymethoxy)-6-trimethylsilyloxycyclohexa-2,4-dien-1-yl]methanone.
| Compound Name | [3-butoxy-5-[(dimethylamino)methyl]-1,2-oxazol-4-yl]-[(1S,6R)-1-(phenylmethoxymethoxy)-6-trimethylsilyloxycyclohexa-2,4-dien-1-yl]methanone |
|---|---|
| PubChem CID | 90208878 |
| Molecular Formula | C28H40N2O6Si |
| Molecular Weight | 528.72 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [3-butoxy-5-[(dimethylamino)methyl]-1,2-oxazol-4-yl]-[(1S,6R)-1-(phenylmethoxymethoxy)-6-trimethylsilyloxycyclohexa-2,4-dien-1-yl]methanone |
| SMILES | CCCCOc1noc(CN(C)C)c1C(=O)[C@]1(OCOCc2ccccc2)C=CC=C[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C28H40N2O6Si/c1-7-8-18-33-27-25(23(35-29-27)19-30(2)3)26(31)28(17-13-12-16-24(28)36-37(4,5)6)34-21-32-20-22-14-10-9-11-15-22/h9-17,24H,7-8,18-21H2,1-6H3/t24-,28+/m1/s1 |
| InChIKey | IPVVCGYRNISERA-YWEHKCAJSA-N |
| XLogP | 5.37 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|