C24H45NO8P2 — CID 90209220
(2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyl-4-phosphanyloxyoxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-phosphanyloxyacetamide (PubChem CID 90209220) has the molecular formula C24H45NO8P2 and a molecular weight of 537.57 g/mol. Its IUPAC name is (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyl-4-phosphanyloxyoxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-phosphanyloxyacetamide.
| Compound Name | (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyl-4-phosphanyloxyoxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-phosphanyloxyacetamide |
|---|---|
| PubChem CID | 90209220 |
| Molecular Formula | C24H45NO8P2 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | (2S)-N-[[(2S,4R,6R)-6-[(2S)-2,3-dimethoxypropyl]-5,5-dimethyl-4-phosphanyloxyoxan-2-yl]methyl]-2-[(2R,5R,6R)-2-methoxy-5,6-dimethyl-4-methylideneoxan-2-yl]-2-phosphanyloxyacetamide |
| SMILES | C=C1C[C@](OC)([C@H](OP)C(=O)NC[C@@H]2C[C@@H](OP)C(C)(C)[C@@H](C[C@@H](COC)OC)O2)O[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C24H45NO8P2/c1-14-11-24(29-8,31-16(3)15(14)2)21(33-35)22(26)25-12-17-9-20(32-34)23(4,5)19(30-17)10-18(28-7)13-27-6/h15-21H,1,9-13,34-35H2,2-8H3,(H,25,26)/t15-,16-,17+,18+,19-,20-,21-,24-/m1/s1 |
| InChIKey | ILUHKOGNYOIUIX-CCRGPOILSA-N |
| XLogP | 3.03 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|