C32H33FN4O4 — CID 90209637
4-[(Z)-1-(4-fluorophenyl)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxoprop-1-en-2-yl]-3-methylbenzoic acid (PubChem CID 90209637) has the molecular formula C32H33FN4O4 and a molecular weight of 556.64 g/mol. Its IUPAC name is 4-[(Z)-1-(4-fluorophenyl)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxoprop-1-en-2-yl]-3-methylbenzoic acid.
| Compound Name | 4-[(Z)-1-(4-fluorophenyl)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxoprop-1-en-2-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 90209637 |
| Molecular Formula | C32H33FN4O4 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | 4-[(Z)-1-(4-fluorophenyl)-1-[[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxoprop-1-en-2-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1/C(C=O)=C(/Nc1ccc2c(c1)CCN2C(=O)CN1CCN(C)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H33FN4O4/c1-21-17-24(32(40)41)5-9-27(21)28(20-38)31(22-3-6-25(33)7-4-22)34-26-8-10-29-23(18-26)11-12-37(29)30(39)19-36-15-13-35(2)14-16-36/h3-10,17-18,20,34H,11-16,19H2,1-2H3,(H,40,41)/b31-28+ |
| InChIKey | XDAFFDOSTCLLKE-CCFHIKDMSA-N |
| XLogP | 4.15 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|