C35H37N5O4 — CID 90209934
methyl (3Z)-3-[[cyclopropyl-[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 90209934) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is methyl (3Z)-3-[[cyclopropyl-[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | methyl (3Z)-3-[[cyclopropyl-[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 90209934 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | methyl (3Z)-3-[[cyclopropyl-[1-[2-(4-methylpiperazin-1-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-phenylmethylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C2=C(/c1ccccc1)N(c1ccc2c(c1)CCN2C(=O)CN1CCN(C)CC1)C1CC1 |
| InChI | InChI=1S/C35H37N5O4/c1-37-16-18-38(19-17-37)22-31(41)39-15-14-24-20-27(11-13-30(24)39)40(26-9-10-26)33(23-6-4-3-5-7-23)32-28-12-8-25(35(43)44-2)21-29(28)36-34(32)42/h3-8,11-13,20-21,26H,9-10,14-19,22H2,1-2H3,(H,36,42)/b33-32- |
| InChIKey | LMSHFYYHXBWMPD-KARKAFJISA-N |
| XLogP | 4.10 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|