C35H36F3N3O5 — CID 90210178
methyl 4-[(Z)-1-[[1-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl]-3-methylbenzoate (PubChem CID 90210178) has the molecular formula C35H36F3N3O5 and a molecular weight of 635.68 g/mol. Its IUPAC name is methyl 4-[(Z)-1-[[1-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[(Z)-1-[[1-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 90210178 |
| Molecular Formula | C35H36F3N3O5 |
| Molecular Weight | 635.68 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | methyl 4-[(Z)-1-[[1-[2-(2,6-dimethylmorpholin-4-yl)acetyl]-2,3-dihydroindol-5-yl]amino]-3-oxo-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(/C(C=O)=C(/Nc2ccc3c(c2)CCN3C(=O)CN2CC(C)OC(C)C2)c2ccc(C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C35H36F3N3O5/c1-21-15-26(34(44)45-4)7-11-29(21)30(20-42)33(24-5-8-27(9-6-24)35(36,37)38)39-28-10-12-31-25(16-28)13-14-41(31)32(43)19-40-17-22(2)46-23(3)18-40/h5-12,15-16,20,22-23,39H,13-14,17-19H2,1-4H3/b33-30+ |
| InChIKey | JNZKSBFONADFIC-KKYHWDRJSA-N |
| XLogP | 5.98 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|