C30H25F3N6OS — CID 90210781
6-(3-methyl-5-thiophen-3-yl-2-pyridinyl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 90210781) has the molecular formula C30H25F3N6OS and a molecular weight of 574.63 g/mol. Its IUPAC name is 6-(3-methyl-5-thiophen-3-yl-2-pyridinyl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(3-methyl-5-thiophen-3-yl-2-pyridinyl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90210781 |
| Molecular Formula | C30H25F3N6OS |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 6-(3-methyl-5-thiophen-3-yl-2-pyridinyl)-2-[4-(1,2,3,6-tetrahydropyridin-4-yl)anilino]-8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(-c2ccsc2)cnc1-c1cc2cnc(Nc3ccc(C4=CCNCC4)cc3)nc2n(CC(F)(F)F)c1=O |
| InChI | InChI=1S/C30H25F3N6OS/c1-18-12-22(21-8-11-41-16-21)14-35-26(18)25-13-23-15-36-29(38-27(23)39(28(25)40)17-30(31,32)33)37-24-4-2-19(3-5-24)20-6-9-34-10-7-20/h2-6,8,11-16,34H,7,9-10,17H2,1H3,(H,36,37,38) |
| InChIKey | VFHZUWGVSSLZBH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |