C16H20BN3O3 — CID 90210897
N-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 90210897) has the molecular formula C16H20BN3O3 and a molecular weight of 313.17 g/mol. Its IUPAC name is N-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 90210897 |
| Molecular Formula | C16H20BN3O3 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-[3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CC1(C)OB(c2cnc(NC(=O)C3CC3)c(C#N)c2)OC1(C)C |
| InChI | InChI=1S/C16H20BN3O3/c1-15(2)16(3,4)23-17(22-15)12-7-11(8-18)13(19-9-12)20-14(21)10-5-6-10/h7,9-10H,5-6H2,1-4H3,(H,19,20,21) |
| InChIKey | DGSTVKJASFBLBJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|