C14H7Cl4N3O4 — CID 90211649
1-[3,5-dichloro-2-(hydroxyamino)phenyl]-3-(3,5-dichloro-2-hydroxyphenyl)-1,3-diazetidine-2,4-dione (PubChem CID 90211649) has the molecular formula C14H7Cl4N3O4 and a molecular weight of 423.04 g/mol. Its IUPAC name is 1-[3,5-dichloro-2-(hydroxyamino)phenyl]-3-(3,5-dichloro-2-hydroxyphenyl)-1,3-diazetidine-2,4-dione.
| Compound Name | 1-[3,5-dichloro-2-(hydroxyamino)phenyl]-3-(3,5-dichloro-2-hydroxyphenyl)-1,3-diazetidine-2,4-dione |
|---|---|
| PubChem CID | 90211649 |
| Molecular Formula | C14H7Cl4N3O4 |
| Molecular Weight | 423.04 g/mol |
| Exact Mass | 420.92 |
| IUPAC Name | 1-[3,5-dichloro-2-(hydroxyamino)phenyl]-3-(3,5-dichloro-2-hydroxyphenyl)-1,3-diazetidine-2,4-dione |
| SMILES | O=C1N(c2cc(Cl)cc(Cl)c2O)C(=O)N1c1cc(Cl)cc(Cl)c1NO |
| InChI | InChI=1S/C14H7Cl4N3O4/c15-5-1-7(17)11(19-25)9(3-5)20-13(23)21(14(20)24)10-4-6(16)2-8(18)12(10)22/h1-4,19,22,25H |
| InChIKey | PKBWOTNKBTVORQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|