About (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one
(E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one (PubChem CID 90211806) has the molecular formula C8H11F2NO
and a molecular weight of 175.18 g/mol. Its IUPAC name is (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one |
| PubChem CID | 90211806 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one |
| SMILES | CC(=O)/C=C/CN1CC(F)(F)C1 |
| InChI | InChI=1S/C8H11F2NO/c1-7(12)3-2-4-11-5-8(9,10)6-11/h2-3H,4-6H2,1H3/b3-2+ |
| InChIKey | CTPLCIQHZVTDJR-NSCUHMNNSA-N |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one?
The IUPAC name of (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one (CID 90211806) is (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one.
What is the SMILES notation for (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one?
The canonical SMILES for (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one is CC(=O)/C=C/CN1CC(F)(F)C1.
What is the InChIKey of (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one?
The InChIKey is CTPLCIQHZVTDJR-NSCUHMNNSA-N. The full InChI is InChI=1S/C8H11F2NO/c1-7(12)3-2-4-11-5-8(9,10)6-11/h2-3H,4-6H2,1H3/b3-2+.
What are the key properties of (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one?
(E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one has a molecular weight of 175.18 g/mol, XLogP of 1.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(3,3-difluoroazetidin-1-yl)pent-3-en-2-one is sourced from PubChem (CID 90211806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).