C11H14N2 — CID 90212284
2,3,4,4a,4b,5-hexahydro-1H-pyrido[3,4-b]indole (PubChem CID 90212284) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,3,4,4a,4b,5-hexahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 2,3,4,4a,4b,5-hexahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 90212284 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,3,4,4a,4b,5-hexahydro-1H-pyrido[3,4-b]indole |
| SMILES | C1=CCC2C(=C1)N=C1CNCCC12 |
| InChI | InChI=1S/C11H14N2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10/h1-2,4,8-9,12H,3,5-7H2 |
| InChIKey | OZYHIFLIOXERPW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |