About triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane
triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane (PubChem CID 90212329) has the molecular formula C10H22F3P
and a molecular weight of 230.25 g/mol. Its IUPAC name is triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane.
Molecular Properties
| Compound Name | triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane |
| PubChem CID | 90212329 |
| Molecular Formula | C10H22F3P |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane |
| SMILES | CCP(C)(CC)(CC)CCC(F)(F)F |
| InChI | InChI=1S/C10H22F3P/c1-5-14(4,6-2,7-3)9-8-10(11,12)13/h5-9H2,1-4H3 |
| InChIKey | GQOURBBIAOFKMW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane?
The IUPAC name of triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane (CID 90212329) is triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane.
What is the SMILES notation for triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane?
The canonical SMILES for triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane is CCP(C)(CC)(CC)CCC(F)(F)F.
What is the InChIKey of triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane?
The InChIKey is GQOURBBIAOFKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22F3P/c1-5-14(4,6-2,7-3)9-8-10(11,12)13/h5-9H2,1-4H3.
What are the key properties of triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane?
triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane has a molecular weight of 230.25 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-methyl-(3,3,3-trifluoropropyl)-λ5-phosphane is sourced from PubChem (CID 90212329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).