C18H22FN7O — CID 90212377
2-[(2R)-2-fluoro-3-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 90212377) has the molecular formula C18H22FN7O and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-[(2R)-2-fluoro-3-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[(2R)-2-fluoro-3-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 90212377 |
| Molecular Formula | C18H22FN7O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[(2R)-2-fluoro-3-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | Cc1cc2cn(-c3ccc(CNC[C@@H](F)CN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C18H22FN7O/c1-11-6-13-10-26(18(27)25-16(13)24-11)15-4-2-12(3-5-15)7-22-8-14(19)9-23-17(20)21/h2-6,10,14,22H,7-9H2,1H3,(H4,20,21,23)(H,24,25,27)/t14-/m1/s1 |
| InChIKey | WOHHDJFCHQCAPP-CQSZACIVSA-N |
| XLogP | 0.72 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|